C14H23N3O2 — CID 106347919
2,4-diamino-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide (PubChem CID 106347919) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2,4-diamino-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide.
| Compound Name | 2,4-diamino-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide |
|---|---|
| PubChem CID | 106347919 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2,4-diamino-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1ccc(N)cc1N |
| InChI | InChI=1S/C14H23N3O2/c1-14(2,3)12(6-7-18)17-13(19)10-5-4-9(15)8-11(10)16/h4-5,8,12,18H,6-7,15-16H2,1-3H3,(H,17,19) |
| InChIKey | PQLXEOWEBSDGGB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|