C14H21ClN2O2 — CID 106347896
3-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide (PubChem CID 106347896) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 3-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide.
| Compound Name | 3-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide |
|---|---|
| PubChem CID | 106347896 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1cc(N)cc(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-14(2,3)12(4-5-18)17-13(19)9-6-10(15)8-11(16)7-9/h6-8,12,18H,4-5,16H2,1-3H3,(H,17,19) |
| InChIKey | NAOYUHRHMKIFDD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|