C14H19ClFNO2 — CID 103941089
5-chloro-2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide (PubChem CID 103941089) has the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide.
| Compound Name | 5-chloro-2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide |
|---|---|
| PubChem CID | 103941089 |
| Molecular Formula | C14H19ClFNO2 |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-chloro-2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H19ClFNO2/c1-14(2,3)12(6-7-18)17-13(19)10-8-9(15)4-5-11(10)16/h4-5,8,12,18H,6-7H2,1-3H3,(H,17,19) |
| InChIKey | GBPUWCJCQLUWHV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |