C14H20FNO2S — CID 106357978
2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-5-sulfanylbenzamide (PubChem CID 106357978) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-5-sulfanylbenzamide.
| Compound Name | 2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 106357978 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-fluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-5-sulfanylbenzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C14H20FNO2S/c1-14(2,3)12(6-7-17)16-13(18)10-8-9(19)4-5-11(10)15/h4-5,8,12,17,19H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | JUXCNVHKZGTXTI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|