C14H19ClN2O4 — CID 106349358
5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-nitrobenzamide (PubChem CID 106349358) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 106349358 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)-2-nitrobenzamide |
| SMILES | CC(C)(C)C(CCO)NC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19ClN2O4/c1-14(2,3)12(6-7-18)16-13(19)10-8-9(15)4-5-11(10)17(20)21/h4-5,8,12,18H,6-7H2,1-3H3,(H,16,19) |
| InChIKey | QIGCHLHNYPDWGZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|