C12H16FNOS — CID 107019385
2-fluoro-N-(2-methylbutan-2-yl)-5-sulfanylbenzamide (PubChem CID 107019385) has the molecular formula C12H16FNOS and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-fluoro-N-(2-methylbutan-2-yl)-5-sulfanylbenzamide.
| Compound Name | 2-fluoro-N-(2-methylbutan-2-yl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107019385 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-fluoro-N-(2-methylbutan-2-yl)-5-sulfanylbenzamide |
| SMILES | CCC(C)(C)NC(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C12H16FNOS/c1-4-12(2,3)14-11(15)9-7-8(16)5-6-10(9)13/h5-7,16H,4H2,1-3H3,(H,14,15) |
| InChIKey | NSILHWUXMRZZOD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|