C15H22BrNOS — CID 107026909
2-bromo-5-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 107026909) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-bromo-5-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 2-bromo-5-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 107026909 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-bromo-5-sulfanyl-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cc(S)ccc1Br |
| InChI | InChI=1S/C15H22BrNOS/c1-14(2,3)9-15(4,5)17-13(18)11-8-10(19)6-7-12(11)16/h6-8,19H,9H2,1-5H3,(H,17,18) |
| InChIKey | NNUSBCDBLJTBAF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|