C15H21BrClNO — CID 81307457
4-bromo-3-chloro-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 81307457) has the molecular formula C15H21BrClNO and a molecular weight of 346.70 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 81307457 |
| Molecular Formula | C15H21BrClNO |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-bromo-3-chloro-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H21BrClNO/c1-14(2,3)9-15(4,5)18-13(19)10-6-7-11(16)12(17)8-10/h6-8H,9H2,1-5H3,(H,18,19) |
| InChIKey | IGELZRSEJKUFMA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |