C19H31NO — CID 974128
4-tert-butyl-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 974128) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 974128 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-tert-butyl-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H31NO/c1-17(2,3)13-19(7,8)20-16(21)14-9-11-15(12-10-14)18(4,5)6/h9-12H,13H2,1-8H3,(H,20,21) |
| InChIKey | FCYMQHKHRZHXAD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |