C18H28N2O2 — CID 17257385
4-(propanoylamino)-N-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 17257385) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4-(propanoylamino)-N-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | 4-(propanoylamino)-N-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 17257385 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 4-(propanoylamino)-N-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NC(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O2/c1-7-15(21)19-14-10-8-13(9-11-14)16(22)20-18(5,6)12-17(2,3)4/h8-11H,7,12H2,1-6H3,(H,19,21)(H,20,22) |
| InChIKey | VOYJNXFUJGXDCC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |