C13H20INOS — CID 79693864
5-iodo-N-(2,4,4-trimethylpentan-2-yl)thiophene-3-carboxamide (PubChem CID 79693864) has the molecular formula C13H20INOS and a molecular weight of 365.28 g/mol. Its IUPAC name is 5-iodo-N-(2,4,4-trimethylpentan-2-yl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(2,4,4-trimethylpentan-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693864 |
| Molecular Formula | C13H20INOS |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 5-iodo-N-(2,4,4-trimethylpentan-2-yl)thiophene-3-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C13H20INOS/c1-12(2,3)8-13(4,5)15-11(16)9-6-10(14)17-7-9/h6-7H,8H2,1-5H3,(H,15,16) |
| InChIKey | HIGNAIZSOKSKME-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|