C11H14INO3S — CID 79685646
4-[(5-iodothiophene-3-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 79685646) has the molecular formula C11H14INO3S and a molecular weight of 367.21 g/mol. Its IUPAC name is 4-[(5-iodothiophene-3-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(5-iodothiophene-3-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 79685646 |
| Molecular Formula | C11H14INO3S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 4-[(5-iodothiophene-3-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C11H14INO3S/c1-11(2,4-3-9(14)15)13-10(16)7-5-8(12)17-6-7/h5-6H,3-4H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | XHWSUHQPENLPTE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|