C12H13IN2OS2 — CID 78948952
N-(4-tert-butyl-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide (PubChem CID 78948952) has the molecular formula C12H13IN2OS2 and a molecular weight of 392.29 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948952 |
| Molecular Formula | C12H13IN2OS2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-5-iodothiophene-3-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2csc(I)c2)n1 |
| InChI | InChI=1S/C12H13IN2OS2/c1-12(2,3)8-6-18-11(14-8)15-10(16)7-4-9(13)17-5-7/h4-6H,1-3H3,(H,14,15,16) |
| InChIKey | FGZMMWMSSHUCEZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|