C9H6ClIN2OS2 — CID 79692806
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-iodothiophene-3-carboxamide (PubChem CID 79692806) has the molecular formula C9H6ClIN2OS2 and a molecular weight of 384.65 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692806 |
| Molecular Formula | C9H6ClIN2OS2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.87 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-iodothiophene-3-carboxamide |
| SMILES | O=C(Nc1nc(CCl)cs1)c1csc(I)c1 |
| InChI | InChI=1S/C9H6ClIN2OS2/c10-2-6-4-16-9(12-6)13-8(14)5-1-7(11)15-3-5/h1,3-4H,2H2,(H,12,13,14) |
| InChIKey | FNQPUDLHGMZNCL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|