C6H4Cl4N2OS — CID 108745925
2,2,2-trichloro-N-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 108745925) has the molecular formula C6H4Cl4N2OS and a molecular weight of 293.99 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 108745925 |
| Molecular Formula | C6H4Cl4N2OS |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.88 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(chloromethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(Nc1nc(CCl)cs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H4Cl4N2OS/c7-1-3-2-14-5(11-3)12-4(13)6(8,9)10/h2H,1H2,(H,11,12,13) |
| InChIKey | PIVWCXICZOUMES-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|