C9H13ClN2O3S — CID 108745935
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108745935) has the molecular formula C9H13ClN2O3S and a molecular weight of 264.73 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108745935 |
| Molecular Formula | C9H13ClN2O3S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H13ClN2O3S/c1-14-2-3-15-5-8(13)12-9-11-7(4-10)6-16-9/h6H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | VLGQUWKXCNHDFQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|