C14H16N2O4S — CID 86622750
phenyl N-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 86622750) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is phenyl N-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | phenyl N-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 86622750 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | phenyl N-[4-(2-methoxyethoxymethyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | COCCOCc1csc(NC(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2O4S/c1-18-7-8-19-9-11-10-21-13(15-11)16-14(17)20-12-5-3-2-4-6-12/h2-6,10H,7-9H2,1H3,(H,15,16,17) |
| InChIKey | TXCVBKZQTOFOSI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|