C6H8N2O3S — CID 87285914
[4-(methoxymethyl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87285914) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is [4-(methoxymethyl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [4-(methoxymethyl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87285914 |
| Molecular Formula | C6H8N2O3S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | [4-(methoxymethyl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | COCc1csc(NC(=O)O)n1 |
| InChI | InChI=1S/C6H8N2O3S/c1-11-2-4-3-12-5(7-4)8-6(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | TXFBISYFYAGETB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |