C5H5N5O2S — CID 90457555
[4-(azidomethyl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 90457555) has the molecular formula C5H5N5O2S and a molecular weight of 199.19 g/mol. Its IUPAC name is [4-(azidomethyl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [4-(azidomethyl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90457555 |
| Molecular Formula | C5H5N5O2S |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | [4-(azidomethyl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | [N-]=[N+]=NCc1csc(NC(=O)O)n1 |
| InChI | InChI=1S/C5H5N5O2S/c6-10-7-1-3-2-13-4(8-3)9-5(11)12/h2H,1H2,(H,8,9)(H,11,12) |
| InChIKey | GDEFEAVHURMLKN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|