C11H14N2OS — CID 72687719
N-(4-ethyl-1,3-thiazol-2-yl)hexa-2,4-dienamide (PubChem CID 72687719) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(4-ethyl-1,3-thiazol-2-yl)hexa-2,4-dienamide.
| Compound Name | N-(4-ethyl-1,3-thiazol-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 72687719 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(4-ethyl-1,3-thiazol-2-yl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)Nc1nc(CC)cs1 |
| InChI | InChI=1S/C11H14N2OS/c1-3-5-6-7-10(14)13-11-12-9(4-2)8-15-11/h3,5-8H,4H2,1-2H3,(H,12,13,14) |
| InChIKey | GGTLHUBDYIYYCY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|