C5H6N2O3S — CID 87112196
[4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87112196) has the molecular formula C5H6N2O3S and a molecular weight of 174.18 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87112196 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | [4-(hydroxymethyl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc(CO)cs1 |
| InChI | InChI=1S/C5H6N2O3S/c8-1-3-2-11-4(6-3)7-5(9)10/h2,8H,1H2,(H,6,7)(H,9,10) |
| InChIKey | KSCAWKNFCFFFPX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |