C7H11N3O3S — CID 174499606
ethyl N-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]carbamate (PubChem CID 174499606) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is ethyl N-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]carbamate.
| Compound Name | ethyl N-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 174499606 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | ethyl N-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]amino]carbamate |
| SMILES | CCOC(=O)NNc1nc(CO)cs1 |
| InChI | InChI=1S/C7H11N3O3S/c1-2-13-7(12)10-9-6-8-5(3-11)4-14-6/h4,11H,2-3H2,1H3,(H,8,9)(H,10,12) |
| InChIKey | IXCUGRKUZSHPIS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|