About ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate
ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate (PubChem CID 110719565) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate.
Analyze ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate?
The IUPAC name of ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate (CID 110719565) is ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate.
What is the SMILES notation for ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate?
The canonical SMILES for ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate is CCOC(=O)NCc1csc(NC)n1.
What is the InChIKey of ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate?
The InChIKey is PIBKDXLZTSMRPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-3-13-8(12)10-4-6-5-14-7(9-2)11-6/h5H,3-4H2,1-2H3,(H,9,11)(H,10,12).
What are the key properties of ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate?
ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate has a molecular weight of 215.28 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[2-(methylamino)-1,3-thiazol-4-yl]methyl]carbamate is sourced from PubChem (CID 110719565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).