C7H11N3O2S — CID 131203421
N-ethoxy-2-(methylamino)-1,3-thiazole-4-carboxamide (PubChem CID 131203421) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is N-ethoxy-2-(methylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethoxy-2-(methylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 131203421 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-ethoxy-2-(methylamino)-1,3-thiazole-4-carboxamide |
| SMILES | CCONC(=O)c1csc(NC)n1 |
| InChI | InChI=1S/C7H11N3O2S/c1-3-12-10-6(11)5-4-13-7(8-2)9-5/h4H,3H2,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | UAJSZYYXFQUHPU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|