C8H9N3O2S — CID 130927332
2-(methylamino)-N-prop-2-ynoxy-1,3-thiazole-4-carboxamide (PubChem CID 130927332) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-(methylamino)-N-prop-2-ynoxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(methylamino)-N-prop-2-ynoxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 130927332 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-(methylamino)-N-prop-2-ynoxy-1,3-thiazole-4-carboxamide |
| SMILES | C#CCONC(=O)c1csc(NC)n1 |
| InChI | InChI=1S/C8H9N3O2S/c1-3-4-13-11-7(12)6-5-14-8(9-2)10-6/h1,5H,4H2,2H3,(H,9,10)(H,11,12) |
| InChIKey | YKBKFOBNGOTPLF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|