About N-ethoxy-1,3-oxazole-4-carboxamide
N-ethoxy-1,3-oxazole-4-carboxamide (PubChem CID 130637813) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is N-ethoxy-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-ethoxy-1,3-oxazole-4-carboxamide |
| PubChem CID | 130637813 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | N-ethoxy-1,3-oxazole-4-carboxamide |
| SMILES | CCONC(=O)c1cocn1 |
| InChI | InChI=1S/C6H8N2O3/c1-2-11-8-6(9)5-3-10-4-7-5/h3-4H,2H2,1H3,(H,8,9) |
| InChIKey | UIBALAVLKAPXFK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-1,3-oxazole-4-carboxamide?
The IUPAC name of N-ethoxy-1,3-oxazole-4-carboxamide (CID 130637813) is N-ethoxy-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-ethoxy-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-ethoxy-1,3-oxazole-4-carboxamide is CCONC(=O)c1cocn1.
What is the InChIKey of N-ethoxy-1,3-oxazole-4-carboxamide?
The InChIKey is UIBALAVLKAPXFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-2-11-8-6(9)5-3-10-4-7-5/h3-4H,2H2,1H3,(H,8,9).
What are the key properties of N-ethoxy-1,3-oxazole-4-carboxamide?
N-ethoxy-1,3-oxazole-4-carboxamide has a molecular weight of 156.14 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 130637813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).