C10H10N2O3S — CID 36767453
N-ethoxy-2-(furan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 36767453) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is N-ethoxy-2-(furan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethoxy-2-(furan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 36767453 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | N-ethoxy-2-(furan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCONC(=O)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C10H10N2O3S/c1-2-15-12-9(13)7-6-16-10(11-7)8-4-3-5-14-8/h3-6H,2H2,1H3,(H,12,13) |
| InChIKey | UBZWEBWFPLZVOL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|