C18H17ClN2O4S — CID 86863749
N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-2-(furan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 86863749) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-2-(furan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-2-(furan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86863749 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[3-chloro-2-(2-ethoxyethoxy)phenyl]-2-(furan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C18H17ClN2O4S/c1-2-23-9-10-25-16-12(19)5-3-6-13(16)20-17(22)14-11-26-18(21-14)15-7-4-8-24-15/h3-8,11H,2,9-10H2,1H3,(H,20,22) |
| InChIKey | XCPCIXSGNYUUIW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|