C8H11N3O3S — CID 16883950
ethyl N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 16883950) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is ethyl N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | ethyl N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 16883950 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | ethyl N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc(CC(N)=O)cs1 |
| InChI | InChI=1S/C8H11N3O3S/c1-2-14-8(13)11-7-10-5(4-15-7)3-6(9)12/h4H,2-3H2,1H3,(H2,9,12)(H,10,11,13) |
| InChIKey | KQHWNFIPIWIVPZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |