C10H15N3O2S — CID 24630482
N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-methylbutanamide (PubChem CID 24630482) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-methylbutanamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 24630482 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1nc(CC(N)=O)cs1 |
| InChI | InChI=1S/C10H15N3O2S/c1-3-6(2)9(15)13-10-12-7(5-16-10)4-8(11)14/h5-6H,3-4H2,1-2H3,(H2,11,14)(H,12,13,15) |
| InChIKey | GAYAIDAXJUWCSA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |