C8H14N4O3S — CID 175234328
[[4-[2-(2-hydroxyethylamino)ethyl]-1,3-thiazol-2-yl]amino]carbamic acid (PubChem CID 175234328) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is [[4-[2-(2-hydroxyethylamino)ethyl]-1,3-thiazol-2-yl]amino]carbamic acid.
| Compound Name | [[4-[2-(2-hydroxyethylamino)ethyl]-1,3-thiazol-2-yl]amino]carbamic acid |
|---|---|
| PubChem CID | 175234328 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | [[4-[2-(2-hydroxyethylamino)ethyl]-1,3-thiazol-2-yl]amino]carbamic acid |
| SMILES | O=C(O)NNc1nc(CCNCCO)cs1 |
| InChI | InChI=1S/C8H14N4O3S/c13-4-3-9-2-1-6-5-16-7(10-6)11-12-8(14)15/h5,9,12-13H,1-4H2,(H,10,11)(H,14,15) |
| InChIKey | FHMAXNIIUNSIEL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|