C10H16N2O2S — CID 106035939
2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]propanoic acid (PubChem CID 106035939) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]propanoic acid.
| Compound Name | 2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 106035939 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]propanoic acid |
| SMILES | Cc1nc(CCNCC(C)C(=O)O)cs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-7(10(13)14)5-11-4-3-9-6-15-8(2)12-9/h6-7,11H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | LOIUTCIGEUPPMU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|