C13H23N3OS — CID 106045094
2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-N-pentan-2-ylacetamide (PubChem CID 106045094) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-N-pentan-2-ylacetamide.
| Compound Name | 2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 106045094 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)CNCCc1csc(C)n1 |
| InChI | InChI=1S/C13H23N3OS/c1-4-5-10(2)15-13(17)8-14-7-6-12-9-18-11(3)16-12/h9-10,14H,4-8H2,1-3H3,(H,15,17) |
| InChIKey | PBVGQABBSKESAL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|