C15H20ClN3O3S2 — CID 87546948
3-chloro-N-[4-[3-(2-hydroxyethylamino)propyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide (PubChem CID 87546948) has the molecular formula C15H20ClN3O3S2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 3-chloro-N-[4-[3-(2-hydroxyethylamino)propyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[4-[3-(2-hydroxyethylamino)propyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 87546948 |
| Molecular Formula | C15H20ClN3O3S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-chloro-N-[4-[3-(2-hydroxyethylamino)propyl]-1,3-thiazol-2-yl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1nc(CCCNCCO)cs1 |
| InChI | InChI=1S/C15H20ClN3O3S2/c1-11-13(16)5-2-6-14(11)24(21,22)19-15-18-12(10-23-15)4-3-7-17-8-9-20/h2,5-6,10,17,20H,3-4,7-9H2,1H3,(H,18,19) |
| InChIKey | UDDUNELJVLBDDA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|