C14H15ClF3N2NaO3S2 — CID 162109566
sodium;3-chloro-2-methyl-N-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide;hydride (PubChem CID 162109566) has the molecular formula C14H15ClF3N2NaO3S2 and a molecular weight of 438.86 g/mol. Its IUPAC name is sodium;3-chloro-2-methyl-N-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide;hydride.
| Compound Name | sodium;3-chloro-2-methyl-N-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide;hydride |
|---|---|
| PubChem CID | 162109566 |
| Molecular Formula | C14H15ClF3N2NaO3S2 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | sodium;3-chloro-2-methyl-N-[4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide;hydride |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1nc(CCOCC(F)(F)F)cs1.[H-].[Na+] |
| InChI | InChI=1S/C14H14ClF3N2O3S2.Na.H/c1-9-11(15)3-2-4-12(9)25(21,22)20-13-19-10(7-24-13)5-6-23-8-14(16,17)18;;/h2-4,7H,5-6,8H2,1H3,(H,19,20);;/q;+1;-1 |
| InChIKey | ZFYVVXCFTJVIRS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|