C12H12BrClN2O2S2 — CID 11292384
N-[4-(2-bromoethyl)-1,3-thiazol-2-yl]-3-chloro-2-methylbenzenesulfonamide (PubChem CID 11292384) has the molecular formula C12H12BrClN2O2S2 and a molecular weight of 395.73 g/mol. Its IUPAC name is N-[4-(2-bromoethyl)-1,3-thiazol-2-yl]-3-chloro-2-methylbenzenesulfonamide.
| Compound Name | N-[4-(2-bromoethyl)-1,3-thiazol-2-yl]-3-chloro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11292384 |
| Molecular Formula | C12H12BrClN2O2S2 |
| Molecular Weight | 395.73 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | N-[4-(2-bromoethyl)-1,3-thiazol-2-yl]-3-chloro-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1nc(CCBr)cs1 |
| InChI | InChI=1S/C12H12BrClN2O2S2/c1-8-10(14)3-2-4-11(8)20(17,18)16-12-15-9(5-6-13)7-19-12/h2-4,7H,5-6H2,1H3,(H,15,16) |
| InChIKey | DIVHULOBFPKRPY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|