C14H16ClN3O4S2 — CID 87545717
2-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-N-methoxy-N-methylacetamide (PubChem CID 87545717) has the molecular formula C14H16ClN3O4S2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 2-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 87545717 |
| Molecular Formula | C14H16ClN3O4S2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)Cc1csc(NS(=O)(=O)c2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C14H16ClN3O4S2/c1-9-11(15)5-4-6-12(9)24(20,21)17-14-16-10(8-23-14)7-13(19)18(2)22-3/h4-6,8H,7H2,1-3H3,(H,16,17) |
| InChIKey | RVGOYEWLPWEFCI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|