C14H17ClN2O5S3 — CID 87546687
3-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]propyl methanesulfonate (PubChem CID 87546687) has the molecular formula C14H17ClN2O5S3 and a molecular weight of 424.95 g/mol. Its IUPAC name is 3-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]propyl methanesulfonate.
| Compound Name | 3-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 87546687 |
| Molecular Formula | C14H17ClN2O5S3 |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 3-[2-[(3-chloro-2-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]propyl methanesulfonate |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1nc(CCCOS(C)(=O)=O)cs1 |
| InChI | InChI=1S/C14H17ClN2O5S3/c1-10-12(15)6-3-7-13(10)25(20,21)17-14-16-11(9-23-14)5-4-8-22-24(2,18)19/h3,6-7,9H,4-5,8H2,1-2H3,(H,16,17) |
| InChIKey | HBNANTYKOKNNMC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|