C10H11N3O2S2 — CID 99833695
1-[4-(methoxymethyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylurea (PubChem CID 99833695) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylurea.
| Compound Name | 1-[4-(methoxymethyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 99833695 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 1-[4-(methoxymethyl)-1,3-thiazol-2-yl]-3-thiophen-3-ylurea |
| SMILES | COCc1csc(NC(=O)Nc2ccsc2)n1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-15-4-8-6-17-10(12-8)13-9(14)11-7-2-3-16-5-7/h2-3,5-6H,4H2,1H3,(H2,11,12,13,14) |
| InChIKey | ZSPNRHTUCRLNIE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |