About 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine
2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine (PubChem CID 131059203) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine |
| PubChem CID | 131059203 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine |
| SMILES | COCc1csc(NN(C)C)n1 |
| InChI | InChI=1S/C7H13N3OS/c1-10(2)9-7-8-6(4-11-3)5-12-7/h5H,4H2,1-3H3,(H,8,9) |
| InChIKey | NVEVIMJQBLBCIG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine?
The IUPAC name of 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine (CID 131059203) is 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine.
What is the SMILES notation for 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine?
The canonical SMILES for 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine is COCc1csc(NN(C)C)n1.
What is the InChIKey of 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine?
The InChIKey is NVEVIMJQBLBCIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-10(2)9-7-8-6(4-11-3)5-12-7/h5H,4H2,1-3H3,(H,8,9).
What are the key properties of 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine?
2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine has a molecular weight of 187.27 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]-1,1-dimethylhydrazine is sourced from PubChem (CID 131059203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).