C11H12N2OS — CID 107507057
2-[4-(methoxymethyl)-1,3-thiazol-2-yl]aniline (PubChem CID 107507057) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]aniline.
| Compound Name | 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 107507057 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-[4-(methoxymethyl)-1,3-thiazol-2-yl]aniline |
| SMILES | COCc1csc(-c2ccccc2N)n1 |
| InChI | InChI=1S/C11H12N2OS/c1-14-6-8-7-15-11(13-8)9-4-2-3-5-10(9)12/h2-5,7H,6,12H2,1H3 |
| InChIKey | HCQKPGUPPVUYNK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|