C10H9ClN2OS — CID 107511905
2-(3-chloro-2-pyridinyl)-4-(methoxymethyl)-1,3-thiazole (PubChem CID 107511905) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 2-(3-chloro-2-pyridinyl)-4-(methoxymethyl)-1,3-thiazole.
| Compound Name | 2-(3-chloro-2-pyridinyl)-4-(methoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 107511905 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-(3-chloro-2-pyridinyl)-4-(methoxymethyl)-1,3-thiazole |
| SMILES | COCc1csc(-c2ncccc2Cl)n1 |
| InChI | InChI=1S/C10H9ClN2OS/c1-14-5-7-6-15-10(13-7)9-8(11)3-2-4-12-9/h2-4,6H,5H2,1H3 |
| InChIKey | YIBMOSNKZHDEPI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |