C10H9ClN2S — CID 97058354
2-(2-chloro-3-pyridinyl)-4-ethyl-1,3-thiazole (PubChem CID 97058354) has the molecular formula C10H9ClN2S and a molecular weight of 224.72 g/mol. Its IUPAC name is 2-(2-chloro-3-pyridinyl)-4-ethyl-1,3-thiazole.
| Compound Name | 2-(2-chloro-3-pyridinyl)-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 97058354 |
| Molecular Formula | C10H9ClN2S |
| Molecular Weight | 224.72 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-(2-chloro-3-pyridinyl)-4-ethyl-1,3-thiazole |
| SMILES | CCc1csc(-c2cccnc2Cl)n1 |
| InChI | InChI=1S/C10H9ClN2S/c1-2-7-6-14-10(13-7)8-4-3-5-12-9(8)11/h3-6H,2H2,1H3 |
| InChIKey | PIJOAWZMVPCAPB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|