C7H3Cl2N3S — CID 135396419
2-chloro-5-(2-chloro-3-pyridinyl)-1,3,4-thiadiazole (PubChem CID 135396419) has the molecular formula C7H3Cl2N3S and a molecular weight of 232.10 g/mol. Its IUPAC name is 2-chloro-5-(2-chloro-3-pyridinyl)-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-(2-chloro-3-pyridinyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 135396419 |
| Molecular Formula | C7H3Cl2N3S |
| Molecular Weight | 232.10 g/mol |
| Exact Mass | 230.94 |
| IUPAC Name | 2-chloro-5-(2-chloro-3-pyridinyl)-1,3,4-thiadiazole |
| SMILES | Clc1nnc(-c2cccnc2Cl)s1 |
| InChI | InChI=1S/C7H3Cl2N3S/c8-5-4(2-1-3-10-5)6-11-12-7(9)13-6/h1-3H |
| InChIKey | CGVKJUAOQNTPIJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.10 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|