C6H3ClN2S2 — CID 14091186
2-chloro-5-thiophen-2-yl-1,3,4-thiadiazole (PubChem CID 14091186) has the molecular formula C6H3ClN2S2 and a molecular weight of 202.69 g/mol. Its IUPAC name is 2-chloro-5-thiophen-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-thiophen-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 14091186 |
| Molecular Formula | C6H3ClN2S2 |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | 2-chloro-5-thiophen-2-yl-1,3,4-thiadiazole |
| SMILES | Clc1nnc(-c2cccs2)s1 |
| InChI | InChI=1S/C6H3ClN2S2/c7-6-9-8-5(11-6)4-2-1-3-10-4/h1-3H |
| InChIKey | LHUJCUVFVTYVIH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |