C9H4ClN3S4 — CID 18708051
2-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,3,4-thiadiazole (PubChem CID 18708051) has the molecular formula C9H4ClN3S4 and a molecular weight of 317.87 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 18708051 |
| Molecular Formula | C9H4ClN3S4 |
| Molecular Weight | 317.87 g/mol |
| Exact Mass | 316.90 |
| IUPAC Name | 2-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,3,4-thiadiazole |
| SMILES | Clc1cnc(Sc2nnc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C9H4ClN3S4/c10-6-4-11-8(15-6)17-9-13-12-7(16-9)5-2-1-3-14-5/h1-4H |
| InChIKey | ZAUQAIQITKHFDQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|