C11H8ClN5S2 — CID 18707764
2-(1-benzyltetrazol-5-yl)sulfanyl-5-chloro-1,3-thiazole (PubChem CID 18707764) has the molecular formula C11H8ClN5S2 and a molecular weight of 309.81 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)sulfanyl-5-chloro-1,3-thiazole.
| Compound Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-5-chloro-1,3-thiazole |
|---|---|
| PubChem CID | 18707764 |
| Molecular Formula | C11H8ClN5S2 |
| Molecular Weight | 309.81 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-5-chloro-1,3-thiazole |
| SMILES | Clc1cnc(Sc2nnnn2Cc2ccccc2)s1 |
| InChI | InChI=1S/C11H8ClN5S2/c12-9-6-13-11(18-9)19-10-14-15-16-17(10)7-8-4-2-1-3-5-8/h1-6H,7H2 |
| InChIKey | OGCDKNJTJOTMPA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|