C12H12N6S2 — CID 43249746
5-[(1-benzyltetrazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine (PubChem CID 43249746) has the molecular formula C12H12N6S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5-[(1-benzyltetrazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(1-benzyltetrazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43249746 |
| Molecular Formula | C12H12N6S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-[(1-benzyltetrazol-5-yl)methylsulfanyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCc2nnnn2Cc2ccccc2)s1 |
| InChI | InChI=1S/C12H12N6S2/c13-12-14-6-11(20-12)19-8-10-15-16-17-18(10)7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H2,13,14) |
| InChIKey | DOYVYOYEIBTEQX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |