C9H8ClN3S2 — CID 43250005
5-[(6-chloro-3-pyridinyl)methylsulfanyl]-1,3-thiazol-2-amine (PubChem CID 43250005) has the molecular formula C9H8ClN3S2 and a molecular weight of 257.77 g/mol. Its IUPAC name is 5-[(6-chloro-3-pyridinyl)methylsulfanyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(6-chloro-3-pyridinyl)methylsulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43250005 |
| Molecular Formula | C9H8ClN3S2 |
| Molecular Weight | 257.77 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 5-[(6-chloro-3-pyridinyl)methylsulfanyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCc2ccc(Cl)nc2)s1 |
| InChI | InChI=1S/C9H8ClN3S2/c10-7-2-1-6(3-12-7)5-14-8-4-13-9(11)15-8/h1-4H,5H2,(H2,11,13) |
| InChIKey | VPTLMFRGDVFZBK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|