C11H11N3OS2 — CID 24692167
3-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]benzamide (PubChem CID 24692167) has the molecular formula C11H11N3OS2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]benzamide.
| Compound Name | 3-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 24692167 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 3-[(2-amino-1,3-thiazol-5-yl)sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1cccc(CSc2cnc(N)s2)c1 |
| InChI | InChI=1S/C11H11N3OS2/c12-10(15)8-3-1-2-7(4-8)6-16-9-5-14-11(13)17-9/h1-5H,6H2,(H2,12,15)(H2,13,14) |
| InChIKey | OTPBBKCUNUARKL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |